C40H36FN7O2 — CID 68932358
tert-butyl N-[[3-[3-(3-fluorophenyl)-1-tritylpyrazolo[4,3-b]pyridin-5-yl]-1H-1,2,4-triazol-5-yl]methyl]-N-methylcarbamate (PubChem CID 68932358) has the molecular formula C40H36FN7O2 and a molecular weight of 665.77 g/mol. Its IUPAC name is tert-butyl N-[[3-[3-(3-fluorophenyl)-1-tritylpyrazolo[4,3-b]pyridin-5-yl]-1H-1,2,4-triazol-5-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-[3-(3-fluorophenyl)-1-tritylpyrazolo[4,3-b]pyridin-5-yl]-1H-1,2,4-triazol-5-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 68932358 |
| Molecular Formula | C40H36FN7O2 |
| Molecular Weight | 665.77 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | tert-butyl N-[[3-[3-(3-fluorophenyl)-1-tritylpyrazolo[4,3-b]pyridin-5-yl]-1H-1,2,4-triazol-5-yl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1nc(-c2ccc3c(n2)c(-c2cccc(F)c2)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)n[nH]1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H36FN7O2/c1-39(2,3)50-38(49)47(4)26-34-43-37(45-44-34)32-23-24-33-36(42-32)35(27-15-14-22-31(41)25-27)46-48(33)40(28-16-8-5-9-17-28,29-18-10-6-11-19-29)30-20-12-7-13-21-30/h5-25H,26H2,1-4H3,(H,43,44,45) |
| InChIKey | PANBGJMBNIFJKA-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.77 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|