C44H43N5O5 — CID 68933189
7-[1,5-dimethyl-3-[(4-morpholin-4-ylphenoxy)methyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid (PubChem CID 68933189) has the molecular formula C44H43N5O5 and a molecular weight of 721.86 g/mol. Its IUPAC name is 7-[1,5-dimethyl-3-[(4-morpholin-4-ylphenoxy)methyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid.
| Compound Name | 7-[1,5-dimethyl-3-[(4-morpholin-4-ylphenoxy)methyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68933189 |
| Molecular Formula | C44H43N5O5 |
| Molecular Weight | 721.86 g/mol |
| Exact Mass | 721.33 |
| IUPAC Name | 7-[1,5-dimethyl-3-[(4-morpholin-4-ylphenoxy)methyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1-(pyridin-3-ylmethyl)indole-2-carboxylic acid |
| SMILES | Cc1c(-c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)n(Cc4cccnc4)c23)c(COc2ccc(N3CCOCC3)cc2)nn1C |
| InChI | InChI=1S/C44H43N5O5/c1-30-41(39(46-47(30)2)29-54-34-19-17-33(18-20-34)48-22-25-52-26-23-48)38-14-6-13-36-37(15-8-24-53-40-16-5-11-32-10-3-4-12-35(32)40)43(44(50)51)49(42(36)38)28-31-9-7-21-45-27-31/h3-7,9-14,16-21,27H,8,15,22-26,28-29H2,1-2H3,(H,50,51) |
| InChIKey | OQRJODLQIUWQDS-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.86 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|