C22H19F2NO — CID 68933307
1-[(2R)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]-4-phenylcyclohexa-2,5-dien-1-ol (PubChem CID 68933307) has the molecular formula C22H19F2NO and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-[(2R)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]-4-phenylcyclohexa-2,5-dien-1-ol.
| Compound Name | 1-[(2R)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]-4-phenylcyclohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 68933307 |
| Molecular Formula | C22H19F2NO |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-[(2R)-5-(2,6-difluorophenyl)-3,4-dihydro-2H-pyrrol-2-yl]-4-phenylcyclohexa-2,5-dien-1-ol |
| SMILES | OC1([C@H]2CCC(c3c(F)cccc3F)=N2)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C22H19F2NO/c23-17-7-4-8-18(24)21(17)19-9-10-20(25-19)22(26)13-11-16(12-14-22)15-5-2-1-3-6-15/h1-8,11-14,16,20,26H,9-10H2/t16?,20-,22?/m1/s1 |
| InChIKey | WYLWHVMKNSRCFP-PWOUQQLPSA-N |
| XLogP | 4.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|