C29H30F2N4O5 — CID 68934104
[3,10-bis[(4-fluorophenyl)methyl]-7-hydroxy-6,9-dioxo-5,10,12-triazatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-yl]methyl-tert-butylcarbamic acid (PubChem CID 68934104) has the molecular formula C29H30F2N4O5 and a molecular weight of 552.58 g/mol. Its IUPAC name is [3,10-bis[(4-fluorophenyl)methyl]-7-hydroxy-6,9-dioxo-5,10,12-triazatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-yl]methyl-tert-butylcarbamic acid.
| Compound Name | [3,10-bis[(4-fluorophenyl)methyl]-7-hydroxy-6,9-dioxo-5,10,12-triazatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-yl]methyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 68934104 |
| Molecular Formula | C29H30F2N4O5 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | [3,10-bis[(4-fluorophenyl)methyl]-7-hydroxy-6,9-dioxo-5,10,12-triazatricyclo[6.3.1.04,12]dodeca-4,7-dien-3-yl]methyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CC1(Cc2ccc(F)cc2)CC2CN(Cc3ccc(F)cc3)C(=O)c3c(O)c(=O)nc1n32)C(=O)O |
| InChI | InChI=1S/C29H30F2N4O5/c1-28(2,3)34(27(39)40)16-29(12-17-4-8-19(30)9-5-17)13-21-15-33(14-18-6-10-20(31)11-7-18)25(38)22-23(36)24(37)32-26(29)35(21)22/h4-11,21,36H,12-16H2,1-3H3,(H,39,40) |
| InChIKey | UYQODTQZCDOJHA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |