About [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid
[5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid (PubChem CID 68934448) has the molecular formula C17H17BrN4O2
and a molecular weight of 389.25 g/mol. Its IUPAC name is [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid.
Molecular Properties
| Compound Name | [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid |
| PubChem CID | 68934448 |
| Molecular Formula | C17H17BrN4O2 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1ccc(-c2cnc3[nH]cc(Br)c3c2)cn1 |
| InChI | InChI=1S/C17H17BrN4O2/c1-17(2,3)22(16(23)24)14-5-4-10(7-19-14)11-6-12-13(18)9-21-15(12)20-8-11/h4-9H,1-3H3,(H,20,21)(H,23,24) |
| InChIKey | FVFFHIGDOMOOPS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid?
The IUPAC name of [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid (CID 68934448) is [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid.
What is the SMILES notation for [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid?
The canonical SMILES for [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid is CC(C)(C)N(C(=O)O)c1ccc(-c2cnc3[nH]cc(Br)c3c2)cn1.
What is the InChIKey of [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid?
The InChIKey is FVFFHIGDOMOOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN4O2/c1-17(2,3)22(16(23)24)14-5-4-10(7-19-14)11-6-12-13(18)9-21-15(12)20-8-11/h4-9H,1-3H3,(H,20,21)(H,23,24).
What are the key properties of [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid?
[5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid has a molecular weight of 389.25 g/mol, XLogP of 4.67, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]-tert-butylcarbamic acid is sourced from PubChem (CID 68934448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).