C34H45N3O4S — CID 68934588
3-[(4-tert-butylphenyl)sulfonylamino]-N-[7-[(3-methylbutylamino)methyl]-3,4-dihydro-2H-chromen-4-yl]-3-phenylpropanamide (PubChem CID 68934588) has the molecular formula C34H45N3O4S and a molecular weight of 591.82 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)sulfonylamino]-N-[7-[(3-methylbutylamino)methyl]-3,4-dihydro-2H-chromen-4-yl]-3-phenylpropanamide.
| Compound Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-[7-[(3-methylbutylamino)methyl]-3,4-dihydro-2H-chromen-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 68934588 |
| Molecular Formula | C34H45N3O4S |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 3-[(4-tert-butylphenyl)sulfonylamino]-N-[7-[(3-methylbutylamino)methyl]-3,4-dihydro-2H-chromen-4-yl]-3-phenylpropanamide |
| SMILES | CC(C)CCNCc1ccc2c(c1)OCCC2NC(=O)CC(NS(=O)(=O)c1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H45N3O4S/c1-24(2)17-19-35-23-25-11-16-29-30(18-20-41-32(29)21-25)36-33(38)22-31(26-9-7-6-8-10-26)37-42(39,40)28-14-12-27(13-15-28)34(3,4)5/h6-16,21,24,30-31,35,37H,17-20,22-23H2,1-5H3,(H,36,38) |
| InChIKey | IEROECPMVDBJMI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|