C33H31BrF3N3O4 — CID 68935277
3-[4-(5-bromo-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid (PubChem CID 68935277) has the molecular formula C33H31BrF3N3O4 and a molecular weight of 670.53 g/mol. Its IUPAC name is 3-[4-(5-bromo-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[4-(5-bromo-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68935277 |
| Molecular Formula | C33H31BrF3N3O4 |
| Molecular Weight | 670.53 g/mol |
| Exact Mass | 669.15 |
| IUPAC Name | 3-[4-(5-bromo-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(-c3ccc(C(=O)N4CCOCC4)cc3C(F)(F)F)cccc2c1CCCCN1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C33H31BrF3N3O4/c34-22-8-10-28-20(18-22)11-13-39(28)12-2-1-4-26-25-6-3-5-24(29(25)38-30(26)32(42)43)23-9-7-21(19-27(23)33(35,36)37)31(41)40-14-16-44-17-15-40/h3,5-10,18-19,38H,1-2,4,11-17H2,(H,42,43) |
| InChIKey | BKHOVKUPALXXSW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.53 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|