C34H26FN5O — CID 68935510
6-fluoro-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole-5-carbohydrazide (PubChem CID 68935510) has the molecular formula C34H26FN5O and a molecular weight of 539.61 g/mol. Its IUPAC name is 6-fluoro-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole-5-carbohydrazide.
| Compound Name | 6-fluoro-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole-5-carbohydrazide |
|---|---|
| PubChem CID | 68935510 |
| Molecular Formula | C34H26FN5O |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 6-fluoro-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole-5-carbohydrazide |
| SMILES | NNC(=O)c1cc2c(/C=C/c3cccnc3)nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2cc1F |
| InChI | InChI=1S/C34H26FN5O/c35-30-22-32-29(21-28(30)33(41)38-36)31(19-18-24-11-10-20-37-23-24)39-40(32)34(25-12-4-1-5-13-25,26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-23H,36H2,(H,38,41)/b19-18+ |
| InChIKey | IJTCAJJTCKTSCG-VHEBQXMUSA-N |
| XLogP | 6.18 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|