C20H19N3O3 — CID 68935629
8-(3-aminophenyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one;propanoic acid (PubChem CID 68935629) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 8-(3-aminophenyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one;propanoic acid.
| Compound Name | 8-(3-aminophenyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one;propanoic acid |
|---|---|
| PubChem CID | 68935629 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 8-(3-aminophenyl)-3,5-dihydropyrrolo[2,3-c]quinolin-4-one;propanoic acid |
| SMILES | CCC(=O)O.Nc1cccc(-c2ccc3[nH]c(=O)c4[nH]ccc4c3c2)c1 |
| InChI | InChI=1S/C17H13N3O.C3H6O2/c18-12-3-1-2-10(8-12)11-4-5-15-14(9-11)13-6-7-19-16(13)17(21)20-15;1-2-3(4)5/h1-9,19H,18H2,(H,20,21);2H2,1H3,(H,4,5) |
| InChIKey | OJOWBCZKPAHRGP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|