About ethyl 2-(4-iodoanilino)acetate
ethyl 2-(4-iodoanilino)acetate (PubChem CID 689360) has the molecular formula C10H12INO2
and a molecular weight of 305.12 g/mol. Its IUPAC name is ethyl 2-(4-iodoanilino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4-iodoanilino)acetate |
| PubChem CID | 689360 |
| Molecular Formula | C10H12INO2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | ethyl 2-(4-iodoanilino)acetate |
| SMILES | CCOC(=O)CNc1ccc(I)cc1 |
| InChI | InChI=1S/C10H12INO2/c1-2-14-10(13)7-12-9-5-3-8(11)4-6-9/h3-6,12H,2,7H2,1H3 |
| InChIKey | VEMDCCDETKYAEB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(4-iodoanilino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-iodoanilino)acetate?
The IUPAC name of ethyl 2-(4-iodoanilino)acetate (CID 689360) is ethyl 2-(4-iodoanilino)acetate.
What is the SMILES notation for ethyl 2-(4-iodoanilino)acetate?
The canonical SMILES for ethyl 2-(4-iodoanilino)acetate is CCOC(=O)CNc1ccc(I)cc1.
What is the InChIKey of ethyl 2-(4-iodoanilino)acetate?
The InChIKey is VEMDCCDETKYAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12INO2/c1-2-14-10(13)7-12-9-5-3-8(11)4-6-9/h3-6,12H,2,7H2,1H3.
What are the key properties of ethyl 2-(4-iodoanilino)acetate?
ethyl 2-(4-iodoanilino)acetate has a molecular weight of 305.12 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-iodoanilino)acetate is sourced from PubChem (CID 689360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).