About 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one
8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one (PubChem CID 68936033) has the molecular formula C11H7IN2O
and a molecular weight of 310.09 g/mol. Its IUPAC name is 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one.
Molecular Properties
| Compound Name | 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one |
| PubChem CID | 68936033 |
| Molecular Formula | C11H7IN2O |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one |
| SMILES | O=c1[nH]c2ccc(I)cc2c2cc[nH]c12 |
| InChI | InChI=1S/C11H7IN2O/c12-6-1-2-9-8(5-6)7-3-4-13-10(7)11(15)14-9/h1-5,13H,(H,14,15) |
| InChIKey | XQBYXOODAOQAFX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one?
The IUPAC name of 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one (CID 68936033) is 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one.
What is the SMILES notation for 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one?
The canonical SMILES for 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one is O=c1[nH]c2ccc(I)cc2c2cc[nH]c12.
What is the InChIKey of 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one?
The InChIKey is XQBYXOODAOQAFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7IN2O/c12-6-1-2-9-8(5-6)7-3-4-13-10(7)11(15)14-9/h1-5,13H,(H,14,15).
What are the key properties of 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one?
8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one has a molecular weight of 310.09 g/mol, XLogP of 2.61, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodo-3,5-dihydropyrrolo[2,3-c]quinolin-4-one is sourced from PubChem (CID 68936033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).