About bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol
bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol (PubChem CID 68936184) has the molecular formula C9H12N4O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol |
| PubChem CID | 68936184 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol |
| SMILES | NCc1cc(C(O)c2cc(CN)on2)no1 |
| InChI | InChI=1S/C9H12N4O3/c10-3-5-1-7(12-15-5)9(14)8-2-6(4-11)16-13-8/h1-2,9,14H,3-4,10-11H2 |
| InChIKey | DHTDXLHKUBSWAX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol?
The IUPAC name of bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol (CID 68936184) is bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol?
The canonical SMILES for bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol is NCc1cc(C(O)c2cc(CN)on2)no1.
What is the InChIKey of bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol?
The InChIKey is DHTDXLHKUBSWAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O3/c10-3-5-1-7(12-15-5)9(14)8-2-6(4-11)16-13-8/h1-2,9,14H,3-4,10-11H2.
What are the key properties of bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol?
bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol has a molecular weight of 224.22 g/mol, XLogP of -0.34, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[5-(aminomethyl)-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 68936184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).