About 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid
3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid (PubChem CID 68936436) has the molecular formula C17H12F2N2O3
and a molecular weight of 330.29 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid |
| PubChem CID | 68936436 |
| Molecular Formula | C17H12F2N2O3 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid |
| SMILES | COc1c(C(=O)O)ccc2[nH]nc(C=Cc3ccc(F)cc3F)c12 |
| InChI | InChI=1S/C17H12F2N2O3/c1-24-16-11(17(22)23)5-7-14-15(16)13(20-21-14)6-3-9-2-4-10(18)8-12(9)19/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | GCSFTHIURBTSDD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid?
The IUPAC name of 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid (CID 68936436) is 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid.
What is the SMILES notation for 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid?
The canonical SMILES for 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid is COc1c(C(=O)O)ccc2[nH]nc(C=Cc3ccc(F)cc3F)c12.
What is the InChIKey of 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid?
The InChIKey is GCSFTHIURBTSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F2N2O3/c1-24-16-11(17(22)23)5-7-14-15(16)13(20-21-14)6-3-9-2-4-10(18)8-12(9)19/h2-8H,1H3,(H,20,21)(H,22,23).
What are the key properties of 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid?
3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid has a molecular weight of 330.29 g/mol, XLogP of 3.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,4-difluorophenyl)ethenyl]-4-methoxy-1H-indazole-5-carboxylic acid is sourced from PubChem (CID 68936436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).