C27H27BClNO2 — CID 68937346
(2Z)-13-chloro-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 68937346) has the molecular formula C27H27BClNO2 and a molecular weight of 443.78 g/mol. Its IUPAC name is (2Z)-13-chloro-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | (2Z)-13-chloro-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 68937346 |
| Molecular Formula | C27H27BClNO2 |
| Molecular Weight | 443.78 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (2Z)-13-chloro-2-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | CC1(C)OB(c2cccc(/C=C3/c4ccc(Cl)cc4CCc4cccnc43)c2)OC1(C)C |
| InChI | InChI=1S/C27H27BClNO2/c1-26(2)27(3,4)32-28(31-26)21-9-5-7-18(15-21)16-24-23-13-12-22(29)17-20(23)11-10-19-8-6-14-30-25(19)24/h5-9,12-17H,10-11H2,1-4H3/b24-16- |
| InChIKey | MRFADZSOOVLDPO-JLPGSUDCSA-N |
| XLogP | 5.72 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.78 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|