C20H23Cl2NO — CID 68937415
N-[(4-tert-butylphenyl)methyl]-3-(3,4-dichlorophenyl)propanamide (PubChem CID 68937415) has the molecular formula C20H23Cl2NO and a molecular weight of 364.32 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-3-(3,4-dichlorophenyl)propanamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-3-(3,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 68937415 |
| Molecular Formula | C20H23Cl2NO |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-3-(3,4-dichlorophenyl)propanamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)CCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23Cl2NO/c1-20(2,3)16-8-4-15(5-9-16)13-23-19(24)11-7-14-6-10-17(21)18(22)12-14/h4-6,8-10,12H,7,11,13H2,1-3H3,(H,23,24) |
| InChIKey | IEFRKCFYOGHMGI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |