About N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride
N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride (PubChem CID 68937823) has the molecular formula C17H21ClN2OS
and a molecular weight of 336.89 g/mol. Its IUPAC name is N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride |
| PubChem CID | 68937823 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride |
| SMILES | CN(C(=O)c1cccs1)[C@@H]1CCNC[C@H]1c1ccccc1.Cl |
| InChI | InChI=1S/C17H20N2OS.ClH/c1-19(17(20)16-8-5-11-21-16)15-9-10-18-12-14(15)13-6-3-2-4-7-13;/h2-8,11,14-15,18H,9-10,12H2,1H3;1H/t14-,15+;/m0./s1 |
| InChIKey | MGRIMEBGXNDEFP-LDXVYITESA-N |
| XLogP | 3.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride?
The IUPAC name of N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride (CID 68937823) is N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride.
What is the SMILES notation for N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride?
The canonical SMILES for N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride is CN(C(=O)c1cccs1)[C@@H]1CCNC[C@H]1c1ccccc1.Cl.
What is the InChIKey of N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride?
The InChIKey is MGRIMEBGXNDEFP-LDXVYITESA-N. The full InChI is InChI=1S/C17H20N2OS.ClH/c1-19(17(20)16-8-5-11-21-16)15-9-10-18-12-14(15)13-6-3-2-4-7-13;/h2-8,11,14-15,18H,9-10,12H2,1H3;1H/t14-,15+;/m0./s1.
What are the key properties of N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride?
N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride has a molecular weight of 336.89 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3R,4R)-3-phenylpiperidin-4-yl]thiophene-2-carboxamide;hydrochloride is sourced from PubChem (CID 68937823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).