About [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol
[(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol (PubChem CID 68937868) has the molecular formula C21H23NO
and a molecular weight of 305.42 g/mol. Its IUPAC name is [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol |
| PubChem CID | 68937868 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol |
| SMILES | N[C@@]1(CO)CC[C@@H](c2ccc(C#CCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C21H23NO/c22-21(16-23)14-13-20(15-21)19-11-9-18(10-12-19)8-4-7-17-5-2-1-3-6-17/h1-3,5-6,9-12,20,23H,7,13-16,22H2/t20-,21+/m1/s1 |
| InChIKey | LICWFGKGXDHGEM-RTWAWAEBSA-N |
| XLogP | 3.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol?
The IUPAC name of [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol (CID 68937868) is [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol.
What is the SMILES notation for [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol?
The canonical SMILES for [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol is N[C@@]1(CO)CC[C@@H](c2ccc(C#CCc3ccccc3)cc2)C1.
What is the InChIKey of [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol?
The InChIKey is LICWFGKGXDHGEM-RTWAWAEBSA-N. The full InChI is InChI=1S/C21H23NO/c22-21(16-23)14-13-20(15-21)19-11-9-18(10-12-19)8-4-7-17-5-2-1-3-6-17/h1-3,5-6,9-12,20,23H,7,13-16,22H2/t20-,21+/m1/s1.
What are the key properties of [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol?
[(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol has a molecular weight of 305.42 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-1-amino-3-[4-(3-phenylprop-1-ynyl)phenyl]cyclopentyl]methanol is sourced from PubChem (CID 68937868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).