About 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile
2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 689382) has the molecular formula C14H12N4S
and a molecular weight of 268.35 g/mol. Its IUPAC name is 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile |
| PubChem CID | 689382 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | Cc1ccccc1C1C(C#N)=C(N)SC(N)=C1C#N |
| InChI | InChI=1S/C14H12N4S/c1-8-4-2-3-5-9(8)12-10(6-15)13(17)19-14(18)11(12)7-16/h2-5,12H,17-18H2,1H3 |
| InChIKey | IOFODHFIISYXLF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile?
The IUPAC name of 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile (CID 689382) is 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile.
What is the SMILES notation for 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile?
The canonical SMILES for 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile is Cc1ccccc1C1C(C#N)=C(N)SC(N)=C1C#N.
What is the InChIKey of 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile?
The InChIKey is IOFODHFIISYXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4S/c1-8-4-2-3-5-9(8)12-10(6-15)13(17)19-14(18)11(12)7-16/h2-5,12H,17-18H2,1H3.
What are the key properties of 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile?
2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile has a molecular weight of 268.35 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diamino-4-(2-methylphenyl)-4H-thiopyran-3,5-dicarbonitrile is sourced from PubChem (CID 689382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).