About 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran
4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran (PubChem CID 68939110) has the molecular formula C14H8Br2Cl2O
and a molecular weight of 422.93 g/mol. Its IUPAC name is 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran.
Molecular Properties
| Compound Name | 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran |
| PubChem CID | 68939110 |
| Molecular Formula | C14H8Br2Cl2O |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 419.83 |
| IUPAC Name | 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran |
| SMILES | Clc1ccc2c(oc3c(CBr)c(Cl)ccc32)c1CBr |
| InChI | InChI=1S/C14H8Br2Cl2O/c15-5-9-11(17)3-1-7-8-2-4-12(18)10(6-16)14(8)19-13(7)9/h1-4H,5-6H2 |
| InChIKey | SCBIBHIFTCOIQW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran?
The IUPAC name of 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran (CID 68939110) is 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran.
What is the SMILES notation for 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran?
The canonical SMILES for 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran is Clc1ccc2c(oc3c(CBr)c(Cl)ccc32)c1CBr.
What is the InChIKey of 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran?
The InChIKey is SCBIBHIFTCOIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Br2Cl2O/c15-5-9-11(17)3-1-7-8-2-4-12(18)10(6-16)14(8)19-13(7)9/h1-4H,5-6H2.
What are the key properties of 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran?
4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran has a molecular weight of 422.93 g/mol, XLogP of 6.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(bromomethyl)-3,7-dichlorodibenzofuran is sourced from PubChem (CID 68939110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).