About 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide
1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide (PubChem CID 68939346) has the molecular formula C18H26Br3N3
and a molecular weight of 524.14 g/mol. Its IUPAC name is 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide.
Molecular Properties
| Compound Name | 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide |
| PubChem CID | 68939346 |
| Molecular Formula | C18H26Br3N3 |
| Molecular Weight | 524.14 g/mol |
| Exact Mass | 520.97 |
| IUPAC Name | 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide |
| SMILES | Br.Br.Br.c1ccc(CCN2CCN(Cc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C18H23N3.3BrH/c1-2-5-17(6-3-1)8-10-20-11-13-21(14-12-20)16-18-7-4-9-19-15-18;;;/h1-7,9,15H,8,10-14,16H2;3*1H |
| InChIKey | ANVHQYZPYGDFSX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.14 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide?
The IUPAC name of 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide (CID 68939346) is 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide.
What is the SMILES notation for 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide?
The canonical SMILES for 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide is Br.Br.Br.c1ccc(CCN2CCN(Cc3cccnc3)CC2)cc1.
What is the InChIKey of 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide?
The InChIKey is ANVHQYZPYGDFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3.3BrH/c1-2-5-17(6-3-1)8-10-20-11-13-21(14-12-20)16-18-7-4-9-19-15-18;;;/h1-7,9,15H,8,10-14,16H2;3*1H.
What are the key properties of 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide?
1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide has a molecular weight of 524.14 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-phenylethyl)-4-(pyridin-3-ylmethyl)piperazine;trihydrobromide is sourced from PubChem (CID 68939346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).