C22H23F3N2O4S2 — CID 68939366
(2S)-2-(3-acetyl-N-(2-thiophen-3-ylacetyl)anilino)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide (PubChem CID 68939366) has the molecular formula C22H23F3N2O4S2 and a molecular weight of 500.56 g/mol. Its IUPAC name is (2S)-2-(3-acetyl-N-(2-thiophen-3-ylacetyl)anilino)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide.
| Compound Name | (2S)-2-(3-acetyl-N-(2-thiophen-3-ylacetyl)anilino)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 68939366 |
| Molecular Formula | C22H23F3N2O4S2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | (2S)-2-(3-acetyl-N-(2-thiophen-3-ylacetyl)anilino)-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
| SMILES | CC(=O)c1cccc(N(C(=O)Cc2ccsc2)[C@@H](CCCSCC(=O)C(F)(F)F)C(N)=O)c1 |
| InChI | InChI=1S/C22H23F3N2O4S2/c1-14(28)16-4-2-5-17(11-16)27(20(30)10-15-7-9-33-12-15)18(21(26)31)6-3-8-32-13-19(29)22(23,24)25/h2,4-5,7,9,11-12,18H,3,6,8,10,13H2,1H3,(H2,26,31)/t18-/m0/s1 |
| InChIKey | RGSPSWBKKIWWTC-SFHVURJKSA-N |
| XLogP | 4.03 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|