C33H31F3N4O6 — CID 68939417
7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-3-[4-(5-nitro-2,3-dihydroindol-1-yl)butyl]-1H-indole-2-carboxylic acid (PubChem CID 68939417) has the molecular formula C33H31F3N4O6 and a molecular weight of 636.63 g/mol. Its IUPAC name is 7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-3-[4-(5-nitro-2,3-dihydroindol-1-yl)butyl]-1H-indole-2-carboxylic acid.
| Compound Name | 7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-3-[4-(5-nitro-2,3-dihydroindol-1-yl)butyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68939417 |
| Molecular Formula | C33H31F3N4O6 |
| Molecular Weight | 636.63 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | 7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-3-[4-(5-nitro-2,3-dihydroindol-1-yl)butyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(-c3ccc(C(=O)N4CCOCC4)cc3C(F)(F)F)cccc2c1CCCCN1CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C33H31F3N4O6/c34-33(35,36)27-19-21(31(41)39-14-16-46-17-15-39)7-9-23(27)24-5-3-6-25-26(30(32(42)43)37-29(24)25)4-1-2-12-38-13-11-20-18-22(40(44)45)8-10-28(20)38/h3,5-10,18-19,37H,1-2,4,11-17H2,(H,42,43) |
| InChIKey | VKBMRBUJIINORD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 129.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|