C27H26ClFN4O3 — CID 68939670
4-chloro-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-fluoro-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 68939670) has the molecular formula C27H26ClFN4O3 and a molecular weight of 508.98 g/mol. Its IUPAC name is 4-chloro-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-fluoro-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | 4-chloro-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-fluoro-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 68939670 |
| Molecular Formula | C27H26ClFN4O3 |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 4-chloro-13-[3-(2,5-dihydropyrrol-1-yl)propyl]-5-fluoro-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | CC12Cc3c([nH]c4cc(F)c(Cl)cc34)C(c3cccc(O)c3)N1C(=O)N(CCCN1CC=CC1)C2=O |
| InChI | InChI=1S/C27H26ClFN4O3/c1-27-15-19-18-13-20(28)21(29)14-22(18)30-23(19)24(16-6-4-7-17(34)12-16)33(27)26(36)32(25(27)35)11-5-10-31-8-2-3-9-31/h2-4,6-7,12-14,24,30,34H,5,8-11,15H2,1H3 |
| InChIKey | QRARJNXTUCCMRI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|