C16H19F3N2O3S — CID 68939684
(2S)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide (PubChem CID 68939684) has the molecular formula C16H19F3N2O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is (2S)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide.
| Compound Name | (2S)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 68939684 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (2S)-2-[(2-phenylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
| SMILES | NC(=O)[C@H](CCCSCC(=O)C(F)(F)F)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H19F3N2O3S/c17-16(18,19)13(22)10-25-8-4-7-12(15(20)24)21-14(23)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H2,20,24)(H,21,23)/t12-/m0/s1 |
| InChIKey | MRHNKNCCWIHLLJ-LBPRGKRZSA-N |
| XLogP | 1.84 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|