About methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate
methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate (PubChem CID 6893971) has the molecular formula C11H14N2O2S2
and a molecular weight of 270.38 g/mol. Its IUPAC name is methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate.
Molecular Properties
| Compound Name | methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate |
| PubChem CID | 6893971 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate |
| SMILES | COc1ccc(/C=N/NC(=S)SC)cc1OC |
| InChI | InChI=1S/C11H14N2O2S2/c1-14-9-5-4-8(6-10(9)15-2)7-12-13-11(16)17-3/h4-7H,1-3H3,(H,13,16)/b12-7+ |
| InChIKey | BNISWIWBOJQPPO-KPKJPENVSA-N |
| XLogP | 2.28 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate?
The IUPAC name of methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate (CID 6893971) is methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate.
What is the SMILES notation for methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate?
The canonical SMILES for methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate is COc1ccc(/C=N/NC(=S)SC)cc1OC.
What is the InChIKey of methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate?
The InChIKey is BNISWIWBOJQPPO-KPKJPENVSA-N. The full InChI is InChI=1S/C11H14N2O2S2/c1-14-9-5-4-8(6-10(9)15-2)7-12-13-11(16)17-3/h4-7H,1-3H3,(H,13,16)/b12-7+.
What are the key properties of methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate?
methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate has a molecular weight of 270.38 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]carbamodithioate is sourced from PubChem (CID 6893971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).