C34H34F3N3O4 — CID 68940397
3-[4-(2-methyl-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid (PubChem CID 68940397) has the molecular formula C34H34F3N3O4 and a molecular weight of 605.66 g/mol. Its IUPAC name is 3-[4-(2-methyl-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[4-(2-methyl-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68940397 |
| Molecular Formula | C34H34F3N3O4 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 3-[4-(2-methyl-2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid |
| SMILES | CC1Cc2ccccc2N1CCCCc1c(C(=O)O)[nH]c2c(-c3ccc(C(=O)N4CCOCC4)cc3C(F)(F)F)cccc12 |
| InChI | InChI=1S/C34H34F3N3O4/c1-21-19-22-7-2-3-11-29(22)40(21)14-5-4-8-27-26-10-6-9-25(30(26)38-31(27)33(42)43)24-13-12-23(20-28(24)34(35,36)37)32(41)39-15-17-44-18-16-39/h2-3,6-7,9-13,20-21,38H,4-5,8,14-19H2,1H3,(H,42,43) |
| InChIKey | CHSVYYAFZORYKW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|