C28H31FN4O4 — CID 68940857
5-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-(2-piperidin-1-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 68940857) has the molecular formula C28H31FN4O4 and a molecular weight of 506.58 g/mol. Its IUPAC name is 5-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-(2-piperidin-1-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | 5-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-(2-piperidin-1-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 68940857 |
| Molecular Formula | C28H31FN4O4 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 5-fluoro-10-(3-hydroxyphenyl)-4-methoxy-15-methyl-13-(2-piperidin-1-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | COc1cc2c3c([nH]c2cc1F)C(c1cccc(O)c1)N1C(=O)N(CCN2CCCCC2)C(=O)C1(C)C3 |
| InChI | InChI=1S/C28H31FN4O4/c1-28-16-20-19-14-23(37-2)21(29)15-22(19)30-24(20)25(17-7-6-8-18(34)13-17)33(28)27(36)32(26(28)35)12-11-31-9-4-3-5-10-31/h6-8,13-15,25,30,34H,3-5,9-12,16H2,1-2H3 |
| InChIKey | SJDOZOAQUMUCDK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|