About 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane
3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane (PubChem CID 68941000) has the molecular formula C24H42N+
and a molecular weight of 344.61 g/mol. Its IUPAC name is 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane |
| PubChem CID | 68941000 |
| Molecular Formula | C24H42N+ |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane |
| SMILES | C[N+]1(C)C2CCCC1CC(C=C(C1CCCCC1)C1CCCCC1)C2 |
| InChI | InChI=1S/C24H42N/c1-25(2)22-14-9-15-23(25)17-19(16-22)18-24(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h18-23H,3-17H2,1-2H3/q+1 |
| InChIKey | GVKGILVUVYJFCY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane?
The IUPAC name of 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane (CID 68941000) is 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane.
What is the SMILES notation for 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane?
The canonical SMILES for 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane is C[N+]1(C)C2CCCC1CC(C=C(C1CCCCC1)C1CCCCC1)C2.
What is the InChIKey of 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane?
The InChIKey is GVKGILVUVYJFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42N/c1-25(2)22-14-9-15-23(25)17-19(16-22)18-24(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h18-23H,3-17H2,1-2H3/q+1.
What are the key properties of 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane?
3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane has a molecular weight of 344.61 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dicyclohexylethenyl)-9,9-dimethyl-9-azoniabicyclo[3.3.1]nonane is sourced from PubChem (CID 68941000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).