C25H24N6O4 — CID 68941202
3-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)amino]-1H-1,2,4-triazol-5-yl]-N-(3,5-dimethoxyphenyl)pyridin-2-amine (PubChem CID 68941202) has the molecular formula C25H24N6O4 and a molecular weight of 472.51 g/mol. Its IUPAC name is 3-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)amino]-1H-1,2,4-triazol-5-yl]-N-(3,5-dimethoxyphenyl)pyridin-2-amine.
| Compound Name | 3-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)amino]-1H-1,2,4-triazol-5-yl]-N-(3,5-dimethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 68941202 |
| Molecular Formula | C25H24N6O4 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 3-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)amino]-1H-1,2,4-triazol-5-yl]-N-(3,5-dimethoxyphenyl)pyridin-2-amine |
| SMILES | COc1cc(Nc2ncccc2-c2nc(N(C3=CC=CCC3)C3=COC=CO3)n[nH]2)cc(OC)c1 |
| InChI | InChI=1S/C25H24N6O4/c1-32-19-13-17(14-20(15-19)33-2)27-23-21(9-6-10-26-23)24-28-25(30-29-24)31(18-7-4-3-5-8-18)22-16-34-11-12-35-22/h3-4,6-7,9-16H,5,8H2,1-2H3,(H,26,27)(H,28,29,30) |
| InChIKey | MZDXBERLEWNDOC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |