About 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide
3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide (PubChem CID 68941268) has the molecular formula C16H19N3OS
and a molecular weight of 301.42 g/mol. Its IUPAC name is 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide |
| PubChem CID | 68941268 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide |
| SMILES | CCc1cc(-c2nc(C)c(C=CC(=O)N(C)C)s2)ccn1 |
| InChI | InChI=1S/C16H19N3OS/c1-5-13-10-12(8-9-17-13)16-18-11(2)14(21-16)6-7-15(20)19(3)4/h6-10H,5H2,1-4H3 |
| InChIKey | KEOSLPQPPQRBDI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide?
The IUPAC name of 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide (CID 68941268) is 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide.
What is the SMILES notation for 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide?
The canonical SMILES for 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide is CCc1cc(-c2nc(C)c(C=CC(=O)N(C)C)s2)ccn1.
What is the InChIKey of 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide?
The InChIKey is KEOSLPQPPQRBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3OS/c1-5-13-10-12(8-9-17-13)16-18-11(2)14(21-16)6-7-15(20)19(3)4/h6-10H,5H2,1-4H3.
What are the key properties of 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide?
3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide has a molecular weight of 301.42 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-yl]-N,N-dimethylprop-2-enamide is sourced from PubChem (CID 68941268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).