C38H33BrN4 — CID 68941531
20-bromo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin (PubChem CID 68941531) has the molecular formula C38H33BrN4 and a molecular weight of 625.61 g/mol. Its IUPAC name is 20-bromo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin.
| Compound Name | 20-bromo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin |
|---|---|
| PubChem CID | 68941531 |
| Molecular Formula | C38H33BrN4 |
| Molecular Weight | 625.61 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 20-bromo-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-2H-porphyrin |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3c(C)cc(C)cc3C)=C3/C=CC(=N3)/C(Br)=C3/CC(C)(C)C(=N3)/C=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C38H33BrN4/c1-21-7-9-25(10-8-21)35-27-12-11-26(40-27)19-33-38(5,6)20-32(43-33)37(39)31-16-15-30(42-31)36(29-14-13-28(35)41-29)34-23(3)17-22(2)18-24(34)4/h7-19H,20H2,1-6H3/b26-19-,33-19-,35-27-,35-28-,36-29+,36-30+,37-31+,37-32+ |
| InChIKey | LOABIIZHYOSHQV-VDLDKKOTSA-N |
| XLogP | 9.45 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.61 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |