C33H32F3N3O4 — CID 68941704
3-[4-(2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid (PubChem CID 68941704) has the molecular formula C33H32F3N3O4 and a molecular weight of 591.63 g/mol. Its IUPAC name is 3-[4-(2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[4-(2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68941704 |
| Molecular Formula | C33H32F3N3O4 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 3-[4-(2,3-dihydroindol-1-yl)butyl]-7-[4-(morpholine-4-carbonyl)-2-(trifluoromethyl)phenyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(-c3ccc(C(=O)N4CCOCC4)cc3C(F)(F)F)cccc2c1CCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C33H32F3N3O4/c34-33(35,36)27-20-22(31(40)39-16-18-43-19-17-39)11-12-23(27)24-8-5-9-25-26(30(32(41)42)37-29(24)25)7-3-4-14-38-15-13-21-6-1-2-10-28(21)38/h1-2,5-6,8-12,20,37H,3-4,7,13-19H2,(H,41,42) |
| InChIKey | OZOMJNDLBBAVJI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|