C42H39N4O3+ — CID 68942233
7-(2-ethyl-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1-[[1-(pyridin-4-ylmethyl)pyridin-1-ium-4-yl]methyl]indole-2-carboxylic acid (PubChem CID 68942233) has the molecular formula C42H39N4O3+ and a molecular weight of 647.80 g/mol. Its IUPAC name is 7-(2-ethyl-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1-[[1-(pyridin-4-ylmethyl)pyridin-1-ium-4-yl]methyl]indole-2-carboxylic acid.
| Compound Name | 7-(2-ethyl-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1-[[1-(pyridin-4-ylmethyl)pyridin-1-ium-4-yl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68942233 |
| Molecular Formula | C42H39N4O3+ |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | 7-(2-ethyl-4-methyl-3-pyridinyl)-3-(3-naphthalen-1-yloxypropyl)-1-[[1-(pyridin-4-ylmethyl)pyridin-1-ium-4-yl]methyl]indole-2-carboxylic acid |
| SMILES | CCc1nccc(C)c1-c1cccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)n(Cc3cc[n+](Cc4ccncc4)cc3)c12 |
| InChI | InChI=1S/C42H38N4O3/c1-3-37-39(29(2)16-23-44-37)36-13-7-12-34-35(14-8-26-49-38-15-6-10-32-9-4-5-11-33(32)38)41(42(47)48)46(40(34)36)28-31-19-24-45(25-20-31)27-30-17-21-43-22-18-30/h4-7,9-13,15-25H,3,8,14,26-28H2,1-2H3/p+1 |
| InChIKey | MOISIYHYOMPDEJ-UHFFFAOYSA-O |
| XLogP | 8.22 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.80 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|