About 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide
7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide (PubChem CID 68942529) has the molecular formula C10H10N4O3
and a molecular weight of 234.22 g/mol. Its IUPAC name is 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide |
| PubChem CID | 68942529 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide |
| SMILES | COc1nc(C(N)=O)cc2c(C(N)=O)c[nH]c12 |
| InChI | InChI=1S/C10H10N4O3/c1-17-10-7-4(2-6(14-10)9(12)16)5(3-13-7)8(11)15/h2-3,13H,1H3,(H2,11,15)(H2,12,16) |
| InChIKey | LFSDYRDUCWYLGL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide?
The IUPAC name of 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide (CID 68942529) is 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide.
What is the SMILES notation for 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide?
The canonical SMILES for 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide is COc1nc(C(N)=O)cc2c(C(N)=O)c[nH]c12.
What is the InChIKey of 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide?
The InChIKey is LFSDYRDUCWYLGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O3/c1-17-10-7-4(2-6(14-10)9(12)16)5(3-13-7)8(11)15/h2-3,13H,1H3,(H2,11,15)(H2,12,16).
What are the key properties of 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide?
7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide has a molecular weight of 234.22 g/mol, XLogP of -0.23, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1H-pyrrolo[2,3-c]pyridine-3,5-dicarboxamide is sourced from PubChem (CID 68942529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).