C22H24N4O5S — CID 68942632
formic acid;N-[(3S)-2-oxo-1-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolidin-3-yl]-1H-indole-6-sulfonamide (PubChem CID 68942632) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is formic acid;N-[(3S)-2-oxo-1-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolidin-3-yl]-1H-indole-6-sulfonamide.
| Compound Name | formic acid;N-[(3S)-2-oxo-1-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolidin-3-yl]-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 68942632 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | formic acid;N-[(3S)-2-oxo-1-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolidin-3-yl]-1H-indole-6-sulfonamide |
| SMILES | O=C1[C@@H](NS(=O)(=O)c2ccc3cc[nH]c3c2)CCN1c1ccc2c(c1)CNCC2.O=CO |
| InChI | InChI=1S/C21H22N4O3S.CH2O2/c26-21-19(24-29(27,28)18-4-2-15-6-9-23-20(15)12-18)7-10-25(21)17-3-1-14-5-8-22-13-16(14)11-17;2-1-3/h1-4,6,9,11-12,19,22-24H,5,7-8,10,13H2;1H,(H,2,3)/t19-;/m0./s1 |
| InChIKey | WMFFEMXIKIIHDP-FYZYNONXSA-N |
| XLogP | 1.60 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|