C19H25F3N2O3S2 — CID 68942805
(2S)-N-cyclopentyl-2-[(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide (PubChem CID 68942805) has the molecular formula C19H25F3N2O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-[(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide.
| Compound Name | (2S)-N-cyclopentyl-2-[(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 68942805 |
| Molecular Formula | C19H25F3N2O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (2S)-N-cyclopentyl-2-[(2-thiophen-3-ylacetyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
| SMILES | O=C(Cc1ccsc1)N[C@@H](CCCSCC(=O)C(F)(F)F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H25F3N2O3S2/c20-19(21,22)16(25)12-28-8-3-6-15(18(27)23-14-4-1-2-5-14)24-17(26)10-13-7-9-29-11-13/h7,9,11,14-15H,1-6,8,10,12H2,(H,23,27)(H,24,26)/t15-/m0/s1 |
| InChIKey | VRWIXTOQBXLFNA-HNNXBMFYSA-N |
| XLogP | 3.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|