C26H30N4O3 — CID 68942835
6-[1-hydroxy-3-[4-(2-methylquinolin-5-yl)piperazin-1-yl]propan-2-yl]-4-methyl-3H-1,4-benzoxazin-2-one (PubChem CID 68942835) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 6-[1-hydroxy-3-[4-(2-methylquinolin-5-yl)piperazin-1-yl]propan-2-yl]-4-methyl-3H-1,4-benzoxazin-2-one.
| Compound Name | 6-[1-hydroxy-3-[4-(2-methylquinolin-5-yl)piperazin-1-yl]propan-2-yl]-4-methyl-3H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 68942835 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 6-[1-hydroxy-3-[4-(2-methylquinolin-5-yl)piperazin-1-yl]propan-2-yl]-4-methyl-3H-1,4-benzoxazin-2-one |
| SMILES | Cc1ccc2c(N3CCN(CC(CO)c4ccc5c(c4)N(C)CC(=O)O5)CC3)cccc2n1 |
| InChI | InChI=1S/C26H30N4O3/c1-18-6-8-21-22(27-18)4-3-5-23(21)30-12-10-29(11-13-30)15-20(17-31)19-7-9-25-24(14-19)28(2)16-26(32)33-25/h3-9,14,20,31H,10-13,15-17H2,1-2H3 |
| InChIKey | JPDSUSQFXUXTFK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|