C23H24ClN5O — CID 68943428
2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(4-chlorophenyl)-8-cyclopropylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 68943428) has the molecular formula C23H24ClN5O and a molecular weight of 421.93 g/mol. Its IUPAC name is 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(4-chlorophenyl)-8-cyclopropylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(4-chlorophenyl)-8-cyclopropylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 68943428 |
| Molecular Formula | C23H24ClN5O |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(4-chlorophenyl)-8-cyclopropylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1c(-c2ccc(Cl)cc2)cc2cnc(NN3CC4CCCC4C3)nc2n1C1CC1 |
| InChI | InChI=1S/C23H24ClN5O/c24-18-6-4-14(5-7-18)20-10-17-11-25-23(26-21(17)29(22(20)30)19-8-9-19)27-28-12-15-2-1-3-16(15)13-28/h4-7,10-11,15-16,19H,1-3,8-9,12-13H2,(H,25,26,27) |
| InChIKey | OQTDUIZGYYNAIT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |