About 2-ethoxy-3-methyl-2H-1,3-thiazole
2-ethoxy-3-methyl-2H-1,3-thiazole (PubChem CID 68943823) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is 2-ethoxy-3-methyl-2H-1,3-thiazole.
Molecular Properties
| Compound Name | 2-ethoxy-3-methyl-2H-1,3-thiazole |
| PubChem CID | 68943823 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 2-ethoxy-3-methyl-2H-1,3-thiazole |
| SMILES | CCOC1SC=CN1C |
| InChI | InChI=1S/C6H11NOS/c1-3-8-6-7(2)4-5-9-6/h4-6H,3H2,1-2H3 |
| InChIKey | XLIPMXWGFLLVRY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-3-methyl-2H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-methyl-2H-1,3-thiazole?
The IUPAC name of 2-ethoxy-3-methyl-2H-1,3-thiazole (CID 68943823) is 2-ethoxy-3-methyl-2H-1,3-thiazole.
What is the SMILES notation for 2-ethoxy-3-methyl-2H-1,3-thiazole?
The canonical SMILES for 2-ethoxy-3-methyl-2H-1,3-thiazole is CCOC1SC=CN1C.
What is the InChIKey of 2-ethoxy-3-methyl-2H-1,3-thiazole?
The InChIKey is XLIPMXWGFLLVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-3-8-6-7(2)4-5-9-6/h4-6H,3H2,1-2H3.
What are the key properties of 2-ethoxy-3-methyl-2H-1,3-thiazole?
2-ethoxy-3-methyl-2H-1,3-thiazole has a molecular weight of 145.23 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-methyl-2H-1,3-thiazole is sourced from PubChem (CID 68943823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).