C40H36N4O — CID 68944297
1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-2-yl]ethanone (PubChem CID 68944297) has the molecular formula C40H36N4O and a molecular weight of 588.76 g/mol. Its IUPAC name is 1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-2-yl]ethanone.
| Compound Name | 1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-2-yl]ethanone |
|---|---|
| PubChem CID | 68944297 |
| Molecular Formula | C40H36N4O |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 1-[17,17-dimethyl-10-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-18H-porphyrin-2-yl]ethanone |
| SMILES | CC(=O)C1=C/C2=C(\c3c(C)cc(C)cc3C)C3=N/C(=C(/c4ccc(C)cc4)C4=N/C(=C\C5=N/C(=C\C1=N2)CC5(C)C)C=C4)C=C3 |
| InChI | InChI=1S/C40H36N4O/c1-22-8-10-27(11-9-22)38-31-13-12-28(41-31)19-36-40(6,7)21-29(42-36)18-34-30(26(5)45)20-35(44-34)39(33-15-14-32(38)43-33)37-24(3)16-23(2)17-25(37)4/h8-20H,21H2,1-7H3/b28-19-,29-18-,34-18-,36-19-,38-31-,38-32-,39-33+,39-35+ |
| InChIKey | OMBJZSPLKOFJLM-SAEQIYIOSA-N |
| XLogP | 8.69 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |