C27H31NO4 — CID 68944683
(10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl) butanoate (PubChem CID 68944683) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is (10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl) butanoate.
| Compound Name | (10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl) butanoate |
|---|---|
| PubChem CID | 68944683 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (10-methoxy-2,2,4-trimethyl-5-prop-2-enyl-1,5-dihydrochromeno[3,4-f]quinolin-9-yl) butanoate |
| SMILES | C=CCC1Oc2ccc(OC(=O)CCC)c(OC)c2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C27H31NO4/c1-7-9-19-24-17(11-12-18-23(24)16(3)15-27(4,5)28-18)25-20(31-19)13-14-21(26(25)30-6)32-22(29)10-8-2/h7,11-15,19,28H,1,8-10H2,2-6H3 |
| InChIKey | GSAZACVOUIRKGJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|