C19H19F2N — CID 68945003
6,9-difluoro-2,2,4-trimethyl-1,5,5a,11-tetrahydroindeno[1,2-g]quinoline (PubChem CID 68945003) has the molecular formula C19H19F2N and a molecular weight of 299.36 g/mol. Its IUPAC name is 6,9-difluoro-2,2,4-trimethyl-1,5,5a,11-tetrahydroindeno[1,2-g]quinoline.
| Compound Name | 6,9-difluoro-2,2,4-trimethyl-1,5,5a,11-tetrahydroindeno[1,2-g]quinoline |
|---|---|
| PubChem CID | 68945003 |
| Molecular Formula | C19H19F2N |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 6,9-difluoro-2,2,4-trimethyl-1,5,5a,11-tetrahydroindeno[1,2-g]quinoline |
| SMILES | CC1=CC(C)(C)NC2=C1CC1C(=Cc3c(F)ccc(F)c31)C2 |
| InChI | InChI=1S/C19H19F2N/c1-10-9-19(2,3)22-17-7-11-6-14-15(20)4-5-16(21)18(14)13(11)8-12(10)17/h4-6,9,13,22H,7-8H2,1-3H3 |
| InChIKey | OHSNAERLGNKIRP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |