C27H28F2N4O4 — CID 68945080
13-[2-(cyclopropylmethylamino)ethyl]-4-(difluoromethoxy)-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 68945080) has the molecular formula C27H28F2N4O4 and a molecular weight of 510.54 g/mol. Its IUPAC name is 13-[2-(cyclopropylmethylamino)ethyl]-4-(difluoromethoxy)-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | 13-[2-(cyclopropylmethylamino)ethyl]-4-(difluoromethoxy)-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 68945080 |
| Molecular Formula | C27H28F2N4O4 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 13-[2-(cyclopropylmethylamino)ethyl]-4-(difluoromethoxy)-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CC12Cc3c([nH]c4ccc(OC(F)F)cc34)C(c3cccc(O)c3)N1C(=O)N(CCNCC1CC1)C2=O |
| InChI | InChI=1S/C27H28F2N4O4/c1-27-13-20-19-12-18(37-25(28)29)7-8-21(19)31-22(20)23(16-3-2-4-17(34)11-16)33(27)26(36)32(24(27)35)10-9-30-14-15-5-6-15/h2-4,7-8,11-12,15,23,25,30-31,34H,5-6,9-10,13-14H2,1H3 |
| InChIKey | YUMULZCYEFVRPK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|