About propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate
propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate (PubChem CID 68945135) has the molecular formula C17H32F2N2O4Si
and a molecular weight of 394.54 g/mol. Its IUPAC name is propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate |
| PubChem CID | 68945135 |
| Molecular Formula | C17H32F2N2O4Si |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate |
| SMILES | CC(C)OC(=O)NN1C(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1C(F)F |
| InChI | InChI=1S/C17H32F2N2O4Si/c1-9(2)24-17(23)20-21-13(15(18)19)14(16(21)22)25-26(10(3)4,11(5)6)12(7)8/h9-15H,1-8H3,(H,20,23)/t13-,14-/m1/s1 |
| InChIKey | VXPAEQYQHAKBEH-ZIAGYGMSSA-N |
| XLogP | 4.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate?
The IUPAC name of propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate (CID 68945135) is propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate.
What is the SMILES notation for propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate?
The canonical SMILES for propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate is CC(C)OC(=O)NN1C(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1C(F)F.
What is the InChIKey of propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate?
The InChIKey is VXPAEQYQHAKBEH-ZIAGYGMSSA-N. The full InChI is InChI=1S/C17H32F2N2O4Si/c1-9(2)24-17(23)20-21-13(15(18)19)14(16(21)22)25-26(10(3)4,11(5)6)12(7)8/h9-15H,1-8H3,(H,20,23)/t13-,14-/m1/s1.
What are the key properties of propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate?
propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate has a molecular weight of 394.54 g/mol, XLogP of 4.07, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[(2R,3R)-2-(difluoromethyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidin-1-yl]carbamate is sourced from PubChem (CID 68945135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).