C28H31BrN4O3 — CID 68945422
13-[2-(azepan-1-yl)ethyl]-4-bromo-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 68945422) has the molecular formula C28H31BrN4O3 and a molecular weight of 551.49 g/mol. Its IUPAC name is 13-[2-(azepan-1-yl)ethyl]-4-bromo-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | 13-[2-(azepan-1-yl)ethyl]-4-bromo-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 68945422 |
| Molecular Formula | C28H31BrN4O3 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 13-[2-(azepan-1-yl)ethyl]-4-bromo-10-(3-hydroxyphenyl)-15-methyl-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CC12Cc3c([nH]c4ccc(Br)cc34)C(c3cccc(O)c3)N1C(=O)N(CCN1CCCCCC1)C2=O |
| InChI | InChI=1S/C28H31BrN4O3/c1-28-17-22-21-16-19(29)9-10-23(21)30-24(22)25(18-7-6-8-20(34)15-18)33(28)27(36)32(26(28)35)14-13-31-11-4-2-3-5-12-31/h6-10,15-16,25,30,34H,2-5,11-14,17H2,1H3 |
| InChIKey | QZSOHXNZULFLOD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|