C23H35NO7 — CID 68946221
2,3-dihydroxybutanedioic acid;(2R)-2-[4-(2-phenylmethoxyethyl)cyclohexyl]pyrrolidine (PubChem CID 68946221) has the molecular formula C23H35NO7 and a molecular weight of 437.53 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(2R)-2-[4-(2-phenylmethoxyethyl)cyclohexyl]pyrrolidine.
| Compound Name | 2,3-dihydroxybutanedioic acid;(2R)-2-[4-(2-phenylmethoxyethyl)cyclohexyl]pyrrolidine |
|---|---|
| PubChem CID | 68946221 |
| Molecular Formula | C23H35NO7 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(2R)-2-[4-(2-phenylmethoxyethyl)cyclohexyl]pyrrolidine |
| SMILES | O=C(O)C(O)C(O)C(=O)O.c1ccc(COCCC2CCC([C@H]3CCCN3)CC2)cc1 |
| InChI | InChI=1S/C19H29NO.C4H6O6/c1-2-5-17(6-3-1)15-21-14-12-16-8-10-18(11-9-16)19-7-4-13-20-19;5-1(3(7)8)2(6)4(9)10/h1-3,5-6,16,18-20H,4,7-15H2;1-2,5-6H,(H,7,8)(H,9,10)/t16?,18?,19-;/m1./s1 |
| InChIKey | PRIFVAIYDBNTDI-PTQFTOPWSA-N |
| XLogP | 2.03 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|