C26H28F4N6O3 — CID 68949220
methyl 2-fluoro-4-[[2-morpholin-4-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,3,4,5,6-hexahydropyrimido[4,5-d]azepin-4-yl]amino]benzoate (PubChem CID 68949220) has the molecular formula C26H28F4N6O3 and a molecular weight of 548.54 g/mol. Its IUPAC name is methyl 2-fluoro-4-[[2-morpholin-4-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,3,4,5,6-hexahydropyrimido[4,5-d]azepin-4-yl]amino]benzoate.
| Compound Name | methyl 2-fluoro-4-[[2-morpholin-4-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,3,4,5,6-hexahydropyrimido[4,5-d]azepin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 68949220 |
| Molecular Formula | C26H28F4N6O3 |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | methyl 2-fluoro-4-[[2-morpholin-4-yl-7-[3-(trifluoromethyl)-2-pyridinyl]-1,2,3,4,5,6-hexahydropyrimido[4,5-d]azepin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC2NC(N3CCOCC3)NC3=C2CCN(c2ncccc2C(F)(F)F)C=C3)cc1F |
| InChI | InChI=1S/C26H28F4N6O3/c1-38-24(37)17-5-4-16(15-20(17)27)32-22-18-6-9-35(23-19(26(28,29)30)3-2-8-31-23)10-7-21(18)33-25(34-22)36-11-13-39-14-12-36/h2-5,7-8,10,15,22,25,32-34H,6,9,11-14H2,1H3 |
| InChIKey | ZHPJCLQFAHIZJB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |