C17H13Cl2N5O4 — CID 68949609
(4,5-dichloro-6-hydroxy-1,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-2-yl)-(4-ethoxyphenyl)carbamic acid (PubChem CID 68949609) has the molecular formula C17H13Cl2N5O4 and a molecular weight of 422.23 g/mol. Its IUPAC name is (4,5-dichloro-6-hydroxy-1,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-2-yl)-(4-ethoxyphenyl)carbamic acid.
| Compound Name | (4,5-dichloro-6-hydroxy-1,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-2-yl)-(4-ethoxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 68949609 |
| Molecular Formula | C17H13Cl2N5O4 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (4,5-dichloro-6-hydroxy-1,6,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,4,7,9,11-pentaen-2-yl)-(4-ethoxyphenyl)carbamic acid |
| SMILES | CCOc1ccc(N(C(=O)O)c2c3c(Cl)c(Cl)n(O)c3nc3ccnn23)cc1 |
| InChI | InChI=1S/C17H13Cl2N5O4/c1-2-28-10-5-3-9(4-6-10)22(17(25)26)16-12-13(18)14(19)24(27)15(12)21-11-7-8-20-23(11)16/h3-8,27H,2H2,1H3,(H,25,26) |
| InChIKey | YEEZTASUJIOZCT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|