C15H21ClN2O2 — CID 68949647
4-methyl-6-(piperidin-3-ylmethyl)-3H-1,4-benzoxazin-2-one;hydrochloride (PubChem CID 68949647) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-methyl-6-(piperidin-3-ylmethyl)-3H-1,4-benzoxazin-2-one;hydrochloride.
| Compound Name | 4-methyl-6-(piperidin-3-ylmethyl)-3H-1,4-benzoxazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 68949647 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-methyl-6-(piperidin-3-ylmethyl)-3H-1,4-benzoxazin-2-one;hydrochloride |
| SMILES | CN1CC(=O)Oc2ccc(CC3CCCNC3)cc21.Cl |
| InChI | InChI=1S/C15H20N2O2.ClH/c1-17-10-15(18)19-14-5-4-11(8-13(14)17)7-12-3-2-6-16-9-12;/h4-5,8,12,16H,2-3,6-7,9-10H2,1H3;1H |
| InChIKey | YBHDPLWNVGWPMN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|