C44H86O7Si — CID 68949858
(2R,3R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-ol (PubChem CID 68949858) has the molecular formula C44H86O7Si and a molecular weight of 755.25 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-ol |
|---|---|
| PubChem CID | 68949858 |
| Molecular Formula | C44H86O7Si |
| Molecular Weight | 755.25 g/mol |
| Exact Mass | 754.61 |
| IUPAC Name | (2R,3R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(3R)-3-methoxydecoxy]-5-[(Z)-octadec-11-enoxy]-6-[(E)-prop-1-enoxy]oxan-3-ol |
| SMILES | C/C=C/OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](OCC[C@@H](CCCCCCC)OC)[C@H]1OCCCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C44H86O7Si/c1-10-13-15-17-18-19-20-21-22-23-24-25-26-27-29-31-35-47-42-41(48-36-33-38(46-7)32-30-28-16-14-11-2)40(45)39(51-43(42)49-34-12-3)37-50-52(8,9)44(4,5)6/h12,19-20,34,38-43,45H,10-11,13-18,21-33,35-37H2,1-9H3/b20-19-,34-12+/t38-,39-,40-,41+,42-,43?/m1/s1 |
| InChIKey | NCNMNMUCWQTUMZ-MWMYKZFYSA-N |
| XLogP | 12.22 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.25 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|